C21H23F2NO4 — CID 30798114
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 30798114) has the molecular formula C21H23F2NO4 and a molecular weight of 391.41 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30798114 |
| Molecular Formula | C21H23F2NO4 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)Cc2cccc(OC)c2)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2NO4/c1-4-27-19-13-15(8-10-18(19)28-21(22)23)9-11-20(25)24(2)14-16-6-5-7-17(12-16)26-3/h5-13,21H,4,14H2,1-3H3/b11-9+ |
| InChIKey | QRJWANRYLGJPHR-PKNBQFBNSA-N |
| XLogP | 4.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|