C21H25NO4 — CID 30798112
(E)-3-(3-ethoxy-4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 30798112) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 30798112 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)Cc2cccc(OC)c2)ccc1OC |
| InChI | InChI=1S/C21H25NO4/c1-5-26-20-14-16(9-11-19(20)25-4)10-12-21(23)22(2)15-17-7-6-8-18(13-17)24-3/h6-14H,5,15H2,1-4H3/b12-10+ |
| InChIKey | XGQDMMHXBVDBJE-ZRDIBKRKSA-N |
| XLogP | 3.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|