C21H22N2O3S — CID 9392392
(E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-ethoxy-4-methoxyphenyl)-N-methylprop-2-enamide (PubChem CID 9392392) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-ethoxy-4-methoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-ethoxy-4-methoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9392392 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-ethoxy-4-methoxyphenyl)-N-methylprop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)N(C)Cc2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C21H22N2O3S/c1-4-26-18-13-15(9-11-17(18)25-3)10-12-21(24)23(2)14-20-22-16-7-5-6-8-19(16)27-20/h5-13H,4,14H2,1-3H3/b12-10+ |
| InChIKey | PUTFHXNPOGNAIP-ZRDIBKRKSA-N |
| XLogP | 4.38 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|