C20H17F2NO4S — CID 7892623
1,3-benzothiazol-2-ylmethyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate (PubChem CID 7892623) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7892623 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCc2nc3ccccc3s2)ccc1OC(F)F |
| InChI | InChI=1S/C20H17F2NO4S/c1-2-25-16-11-13(7-9-15(16)27-20(21)22)8-10-19(24)26-12-18-23-14-5-3-4-6-17(14)28-18/h3-11,20H,2,12H2,1H3/b10-8+ |
| InChIKey | CVDCKJKENPSCQW-CSKARUKUSA-N |
| XLogP | 5.05 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|