C20H19F2N3O3 — CID 78769813
N-(1H-benzimidazol-2-ylmethyl)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide (PubChem CID 78769813) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 78769813 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NCc2nc3ccccc3[nH]2)ccc1OC(F)F |
| InChI | InChI=1S/C20H19F2N3O3/c1-2-27-17-11-13(7-9-16(17)28-20(21)22)8-10-19(26)23-12-18-24-14-5-3-4-6-15(14)25-18/h3-11,20H,2,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | WGWHTBRSPHFXNQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|