C23H27F2NO4 — CID 55748178
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]prop-2-enamide (PubChem CID 55748178) has the molecular formula C23H27F2NO4 and a molecular weight of 419.47 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55748178 |
| Molecular Formula | C23H27F2NO4 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2cccc(COC(C)C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C23H27F2NO4/c1-4-28-21-13-17(8-10-20(21)30-23(24)25)9-11-22(27)26-14-18-6-5-7-19(12-18)15-29-16(2)3/h5-13,16,23H,4,14-15H2,1-3H3,(H,26,27)/b11-9+ |
| InChIKey | SMLJYKBZLRSDRM-PKNBQFBNSA-N |
| XLogP | 4.94 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|