C21H25NO5 — CID 9241050
(E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide (PubChem CID 9241050) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9241050 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(3-ethoxy-4-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2ccc(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C21H25NO5/c1-5-27-20-12-15(6-9-18(20)25-3)8-11-21(23)22-14-16-7-10-17(24-2)19(13-16)26-4/h6-13H,5,14H2,1-4H3,(H,22,23)/b11-8+ |
| InChIKey | MFXZCTIXAONZQN-DHZHZOJOSA-N |
| XLogP | 3.44 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|