C17H18F2N2O3S — CID 37157625
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(4-methyl-1,3-thiazol-2-yl)methyl]prop-2-enamide (PubChem CID 37157625) has the molecular formula C17H18F2N2O3S and a molecular weight of 368.41 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(4-methyl-1,3-thiazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(4-methyl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 37157625 |
| Molecular Formula | C17H18F2N2O3S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[(4-methyl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCc2nc(C)cs2)ccc1OC(F)F |
| InChI | InChI=1S/C17H18F2N2O3S/c1-3-23-14-8-12(4-6-13(14)24-17(18)19)5-7-15(22)20-9-16-21-11(2)10-25-16/h4-8,10,17H,3,9H2,1-2H3,(H,20,22)/b7-5+ |
| InChIKey | DYEHNEHKGQWNSF-FNORWQNLSA-N |
| XLogP | 3.78 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|