C18H22F2N2O4 — CID 51153100
N-[2-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 51153100) has the molecular formula C18H22F2N2O4 and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[2-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 51153100 |
| Molecular Formula | C18H22F2N2O4 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[2-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCCNC(=O)C2CC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H22F2N2O4/c1-2-25-15-11-12(3-7-14(15)26-18(19)20)4-8-16(23)21-9-10-22-17(24)13-5-6-13/h3-4,7-8,11,13,18H,2,5-6,9-10H2,1H3,(H,21,23)(H,22,24)/b8-4+ |
| InChIKey | ONEWLRILLFSSAS-XBXARRHUSA-N |
| XLogP | 2.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|