C21H30F2N2O3 — CID 76858469
N-[3-(azepan-1-yl)propyl]-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide (PubChem CID 76858469) has the molecular formula C21H30F2N2O3 and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76858469 |
| Molecular Formula | C21H30F2N2O3 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NCCCN2CCCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C21H30F2N2O3/c1-2-27-19-16-17(8-10-18(19)28-21(22)23)9-11-20(26)24-12-7-15-25-13-5-3-4-6-14-25/h8-11,16,21H,2-7,12-15H2,1H3,(H,24,26) |
| InChIKey | CNJZRYKVXWELOV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|