C24H28F2N2O4 — CID 55906567
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]prop-2-enamide (PubChem CID 55906567) has the molecular formula C24H28F2N2O4 and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55906567 |
| Molecular Formula | C24H28F2N2O4 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[4-(2-morpholin-4-ylethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)Nc2ccc(CCN3CCOCC3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C24H28F2N2O4/c1-2-31-22-17-19(5-9-21(22)32-24(25)26)6-10-23(29)27-20-7-3-18(4-8-20)11-12-28-13-15-30-16-14-28/h3-10,17,24H,2,11-16H2,1H3,(H,27,29) |
| InChIKey | VWCZQBDBUHUBSR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|