C22H32F2N2O4 — CID 55520620
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(4-methyl-2-morpholin-4-ylpentyl)prop-2-enamide (PubChem CID 55520620) has the molecular formula C22H32F2N2O4 and a molecular weight of 426.50 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(4-methyl-2-morpholin-4-ylpentyl)prop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(4-methyl-2-morpholin-4-ylpentyl)prop-2-enamide |
|---|---|
| PubChem CID | 55520620 |
| Molecular Formula | C22H32F2N2O4 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(4-methyl-2-morpholin-4-ylpentyl)prop-2-enamide |
| SMILES | CCOc1cc(C=CC(=O)NCC(CC(C)C)N2CCOCC2)ccc1OC(F)F |
| InChI | InChI=1S/C22H32F2N2O4/c1-4-29-20-14-17(5-7-19(20)30-22(23)24)6-8-21(27)25-15-18(13-16(2)3)26-9-11-28-12-10-26/h5-8,14,16,18,22H,4,9-13,15H2,1-3H3,(H,25,27) |
| InChIKey | PVXLMXPOSJQVPL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|