C18H26F2N2O3 — CID 134027068
4-(difluoromethoxy)-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide (PubChem CID 134027068) has the molecular formula C18H26F2N2O3 and a molecular weight of 356.41 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide |
|---|---|
| PubChem CID | 134027068 |
| Molecular Formula | C18H26F2N2O3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 4-(difluoromethoxy)-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide |
| SMILES | CC(C)CC(CNC(=O)c1ccc(OC(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H26F2N2O3/c1-13(2)11-15(22-7-9-24-10-8-22)12-21-17(23)14-3-5-16(6-4-14)25-18(19)20/h3-6,13,15,18H,7-12H2,1-2H3,(H,21,23) |
| InChIKey | ZTEYGOOZMJRHLU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |