C23H37N3O4S — CID 24633664
N-(4-methyl-2-morpholin-4-ylpentyl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 24633664) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is N-(4-methyl-2-morpholin-4-ylpentyl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-methyl-2-morpholin-4-ylpentyl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 24633664 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-(4-methyl-2-morpholin-4-ylpentyl)-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC(C)CC(CNC(=O)c1ccc(S(=O)(=O)N2CCC(C)CC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H37N3O4S/c1-18(2)16-21(25-12-14-30-15-13-25)17-24-23(27)20-4-6-22(7-5-20)31(28,29)26-10-8-19(3)9-11-26/h4-7,18-19,21H,8-17H2,1-3H3,(H,24,27) |
| InChIKey | FOPWGQUSHPFRAK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |