C21H33N3O4 — CID 55520878
4-ethoxy-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide (PubChem CID 55520878) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55520878 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 4-ethoxy-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)NCC(CC(C)C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H33N3O4/c1-4-28-19-7-5-17(6-8-19)21(26)23-15-20(25)22-14-18(13-16(2)3)24-9-11-27-12-10-24/h5-8,16,18H,4,9-15H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | GVYKRKAWCMJLCH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |