C19H28FN3O3 — CID 78840417
3-fluoro-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide (PubChem CID 78840417) has the molecular formula C19H28FN3O3 and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-fluoro-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 78840417 |
| Molecular Formula | C19H28FN3O3 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-fluoro-N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)CC(CNC(=O)CNC(=O)c1cccc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H28FN3O3/c1-14(2)10-17(23-6-8-26-9-7-23)12-21-18(24)13-22-19(25)15-4-3-5-16(20)11-15/h3-5,11,14,17H,6-10,12-13H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | GVSRGPIKGCXUQP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |