C17H24FIN2O2 — CID 55688167
4-fluoro-2-iodo-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide (PubChem CID 55688167) has the molecular formula C17H24FIN2O2 and a molecular weight of 434.29 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide.
| Compound Name | 4-fluoro-2-iodo-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide |
|---|---|
| PubChem CID | 55688167 |
| Molecular Formula | C17H24FIN2O2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-fluoro-2-iodo-N-(4-methyl-2-morpholin-4-ylpentyl)benzamide |
| SMILES | CC(C)CC(CNC(=O)c1ccc(F)cc1I)N1CCOCC1 |
| InChI | InChI=1S/C17H24FIN2O2/c1-12(2)9-14(21-5-7-23-8-6-21)11-20-17(22)15-4-3-13(18)10-16(15)19/h3-4,10,12,14H,5-9,11H2,1-2H3,(H,20,22) |
| InChIKey | VZKUCOWQYJHSND-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|