C22H26F2N2O3S — CID 46400467
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide (PubChem CID 46400467) has the molecular formula C22H26F2N2O3S and a molecular weight of 436.52 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 46400467 |
| Molecular Formula | C22H26F2N2O3S |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C/C(=O)NCC(C)N2CCc3sccc3C2)ccc1OC(F)F |
| InChI | InChI=1S/C22H26F2N2O3S/c1-3-28-19-12-16(4-6-18(19)29-22(23)24)5-7-21(27)25-13-15(2)26-10-8-20-17(14-26)9-11-30-20/h4-7,9,11-12,15,22H,3,8,10,13-14H2,1-2H3,(H,25,27)/b7-5+ |
| InChIKey | TVFCTRCORAJNSU-FNORWQNLSA-N |
| XLogP | 4.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|