C21H25ClN2O3S — CID 46423626
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide (PubChem CID 46423626) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 46423626 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(C)N2CCc3sccc3C2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H25ClN2O3S/c1-14(24-8-6-19-16(13-24)7-9-28-19)12-23-20(25)5-4-15-10-17(22)21(27-3)18(11-15)26-2/h4-5,7,9-11,14H,6,8,12-13H2,1-3H3,(H,23,25)/b5-4+ |
| InChIKey | MLKWLYWQDGEMSO-SNAWJCMRSA-N |
| XLogP | 3.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|