C21H21F2NO3 — CID 31309495
(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one (PubChem CID 31309495) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 31309495 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]-1-(3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCc3ccccc3C2)ccc1OC(F)F |
| InChI | InChI=1S/C21H21F2NO3/c1-2-26-19-13-15(7-9-18(19)27-21(22)23)8-10-20(25)24-12-11-16-5-3-4-6-17(16)14-24/h3-10,13,21H,2,11-12,14H2,1H3/b10-8+ |
| InChIKey | UBLJRKQWGWXVIP-CSKARUKUSA-N |
| XLogP | 4.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|