C24H26N2O3 — CID 41268548
(E)-3-(3,4-diethoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one (PubChem CID 41268548) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (E)-3-(3,4-diethoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-diethoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 41268548 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (E)-3-(3,4-diethoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCc3[nH]c4ccccc4c3C2)cc1OCC |
| InChI | InChI=1S/C24H26N2O3/c1-3-28-22-11-9-17(15-23(22)29-4-2)10-12-24(27)26-14-13-21-19(16-26)18-7-5-6-8-20(18)25-21/h5-12,15,25H,3-4,13-14,16H2,1-2H3/b12-10+ |
| InChIKey | ITKOQXYGBGZYOD-ZRDIBKRKSA-N |
| XLogP | 4.56 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|