C26H29N3O4 — CID 55810468
3-(4-ethoxy-3-methoxyphenyl)-1-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 55810468) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methoxyphenyl)-1-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(4-ethoxy-3-methoxyphenyl)-1-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55810468 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-(4-ethoxy-3-methoxyphenyl)-1-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)N2CCN(C(=O)Cc3c[nH]c4ccccc34)CC2)cc1OC |
| InChI | InChI=1S/C26H29N3O4/c1-3-33-23-10-8-19(16-24(23)32-2)9-11-25(30)28-12-14-29(15-13-28)26(31)17-20-18-27-22-7-5-4-6-21(20)22/h4-11,16,18,27H,3,12-15,17H2,1-2H3 |
| InChIKey | PISRFSLBBKXTQK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|