C25H29NO4 — CID 55506249
(E)-1-(4-benzoylpiperidin-1-yl)-3-(3,4-diethoxyphenyl)prop-2-en-1-one (PubChem CID 55506249) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (E)-1-(4-benzoylpiperidin-1-yl)-3-(3,4-diethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-(3,4-diethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55506249 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-(3,4-diethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCC(C(=O)c3ccccc3)CC2)cc1OCC |
| InChI | InChI=1S/C25H29NO4/c1-3-29-22-12-10-19(18-23(22)30-4-2)11-13-24(27)26-16-14-21(15-17-26)25(28)20-8-6-5-7-9-20/h5-13,18,21H,3-4,14-17H2,1-2H3/b13-11+ |
| InChIKey | KSIJVLUNPCIYIF-ACCUITESSA-N |
| XLogP | 4.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|