C25H25NO4 — CID 58244979
(E)-4-[3-[(E)-3-(4-benzoylpiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]-1-hydroxybut-3-en-2-one (PubChem CID 58244979) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-4-[3-[(E)-3-(4-benzoylpiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]-1-hydroxybut-3-en-2-one.
| Compound Name | (E)-4-[3-[(E)-3-(4-benzoylpiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 58244979 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E)-4-[3-[(E)-3-(4-benzoylpiperidin-1-yl)-3-oxoprop-1-enyl]phenyl]-1-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C/c1cccc(/C=C/C(=O)N2CCC(C(=O)c3ccccc3)CC2)c1)CO |
| InChI | InChI=1S/C25H25NO4/c27-18-23(28)11-9-19-5-4-6-20(17-19)10-12-24(29)26-15-13-22(14-16-26)25(30)21-7-2-1-3-8-21/h1-12,17,22,27H,13-16,18H2/b11-9+,12-10+ |
| InChIKey | AWAVQBUNQRJMJS-WGDLNXRISA-N |
| XLogP | 3.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|