C21H19Cl2NO2 — CID 41309388
(E)-1-(4-benzoylpiperidin-1-yl)-3-(2,6-dichlorophenyl)prop-2-en-1-one (PubChem CID 41309388) has the molecular formula C21H19Cl2NO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is (E)-1-(4-benzoylpiperidin-1-yl)-3-(2,6-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-(2,6-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 41309388 |
| Molecular Formula | C21H19Cl2NO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-(2,6-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)/C=C/c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H19Cl2NO2/c22-18-7-4-8-19(23)17(18)9-10-20(25)24-13-11-16(12-14-24)21(26)15-5-2-1-3-6-15/h1-10,16H,11-14H2/b10-9+ |
| InChIKey | NCYSKFKDJZKBSD-MDZDMXLPSA-N |
| XLogP | 5.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|