C17H20Cl2N2O2 — CID 78779450
1-[3-(2,6-dichlorophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 78779450) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78779450 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)C=Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-20(2)17(23)12-8-10-21(11-9-12)16(22)7-6-13-14(18)4-3-5-15(13)19/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | FDMKYOFJNKVICW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|