C13H11Cl2NO3 — CID 77034589
1-[3-(2,6-dichlorophenyl)prop-2-enoyl]azetidine-3-carboxylic acid (PubChem CID 77034589) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 77034589 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 1-[3-(2,6-dichlorophenyl)prop-2-enoyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)C=Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C13H11Cl2NO3/c14-10-2-1-3-11(15)9(10)4-5-12(17)16-6-8(7-16)13(18)19/h1-5,8H,6-7H2,(H,18,19) |
| InChIKey | FZGAJCAZVVEKGK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|