C17H20FN3O4 — CID 103599105
1-[3-(4-fluoro-2-nitrophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide (PubChem CID 103599105) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is 1-[3-(4-fluoro-2-nitrophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide.
| Compound Name | 1-[3-(4-fluoro-2-nitrophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 103599105 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[3-(4-fluoro-2-nitrophenyl)prop-2-enoyl]-N,N-dimethylpiperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCN(C(=O)C=Cc2ccc(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H20FN3O4/c1-19(2)17(23)13-7-9-20(10-8-13)16(22)6-4-12-3-5-14(18)11-15(12)21(24)25/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | KIUCDKNHHYLNIO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|