C18H22FN3O3 — CID 95616198
(E)-3-(4-fluoro-2-nitrophenyl)-1-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 95616198) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is (E)-3-(4-fluoro-2-nitrophenyl)-1-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluoro-2-nitrophenyl)-1-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 95616198 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (E)-3-(4-fluoro-2-nitrophenyl)-1-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1[N+](=O)[O-])N1CCC[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C18H22FN3O3/c19-15-7-5-14(17(12-15)22(24)25)6-8-18(23)21-11-3-4-16(13-21)20-9-1-2-10-20/h5-8,12,16H,1-4,9-11,13H2/b8-6+/t16-/m0/s1 |
| InChIKey | VTUYVCDTEIVEHN-BVBGJJFLSA-N |
| XLogP | 2.83 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|