C17H23N3O3 — CID 95336608
(3-methyl-4-nitrophenyl)-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]methanone (PubChem CID 95336608) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3-methyl-4-nitrophenyl)-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]methanone.
| Compound Name | (3-methyl-4-nitrophenyl)-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95336608 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (3-methyl-4-nitrophenyl)-[(3S)-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@H](N3CCCC3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N3O3/c1-13-11-14(6-7-16(13)20(22)23)17(21)19-10-4-5-15(12-19)18-8-2-3-9-18/h6-7,11,15H,2-5,8-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | UNZSEMKCZXDZKH-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|