C15H20N2O3 — CID 2857981
(3,5-dimethylpiperidin-1-yl)-(3-methyl-4-nitrophenyl)methanone (PubChem CID 2857981) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3,5-dimethylpiperidin-1-yl)-(3-methyl-4-nitrophenyl)methanone.
| Compound Name | (3,5-dimethylpiperidin-1-yl)-(3-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 2857981 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3,5-dimethylpiperidin-1-yl)-(3-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(C)CC(C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O3/c1-10-6-11(2)9-16(8-10)15(18)13-4-5-14(17(19)20)12(3)7-13/h4-5,7,10-11H,6,8-9H2,1-3H3 |
| InChIKey | YQVFNVMYAHQUOB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|