C18H23N3O3 — CID 98513021
(Z)-3-(3-nitrophenyl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 98513021) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (Z)-3-(3-nitrophenyl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(3-nitrophenyl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 98513021 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (Z)-3-(3-nitrophenyl)-1-[(3R)-3-pyrrolidin-1-ylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C\c1cccc([N+](=O)[O-])c1)N1CCC[C@@H](N2CCCC2)C1 |
| InChI | InChI=1S/C18H23N3O3/c22-18(9-8-15-5-3-6-16(13-15)21(23)24)20-12-4-7-17(14-20)19-10-1-2-11-19/h3,5-6,8-9,13,17H,1-2,4,7,10-12,14H2/b9-8-/t17-/m1/s1 |
| InChIKey | JJIDRIXCRMATSZ-XZVRFQMRSA-N |
| XLogP | 2.69 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|