C20H20N2O3Se — CID 175757597
3-(3-nitrophenyl)-1-(3-phenylselanylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 175757597) has the molecular formula C20H20N2O3Se and a molecular weight of 415.35 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-1-(3-phenylselanylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(3-nitrophenyl)-1-(3-phenylselanylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175757597 |
| Molecular Formula | C20H20N2O3Se |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-(3-nitrophenyl)-1-(3-phenylselanylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)N1CCCC([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C20H20N2O3Se/c23-20(12-11-16-6-4-7-17(14-16)22(24)25)21-13-5-10-19(15-21)26-18-8-2-1-3-9-18/h1-4,6-9,11-12,14,19H,5,10,13,15H2 |
| InChIKey | VJNVUJABZBEEMP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|