C21H22N2O3 — CID 47091880
(E)-1-(2-benzylpiperidin-1-yl)-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 47091880) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-1-(2-benzylpiperidin-1-yl)-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-benzylpiperidin-1-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 47091880 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-1-(2-benzylpiperidin-1-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)N1CCCCC1Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c24-21(13-12-18-9-6-11-20(16-18)23(25)26)22-14-5-4-10-19(22)15-17-7-2-1-3-8-17/h1-3,6-9,11-13,16,19H,4-5,10,14-15H2/b13-12+ |
| InChIKey | AAHVZQVAQSIOMX-OUKQBFOZSA-N |
| XLogP | 4.23 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|