C14H14N2O4 — CID 164563597
1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]piperidin-2-one (PubChem CID 164563597) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]piperidin-2-one.
| Compound Name | 1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]piperidin-2-one |
|---|---|
| PubChem CID | 164563597 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]piperidin-2-one |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)N1CCCCC1=O |
| InChI | InChI=1S/C14H14N2O4/c17-13-6-1-2-9-15(13)14(18)8-7-11-4-3-5-12(10-11)16(19)20/h3-5,7-8,10H,1-2,6,9H2/b8-7+ |
| InChIKey | QVXALFBMJLTWNJ-BQYQJAHWSA-N |
| XLogP | 2.15 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|