C19H19N3O5S — CID 26769636
N,N-dimethyl-1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 26769636) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N,N-dimethyl-1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-dimethyl-1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 26769636 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N,N-dimethyl-1-[(E)-3-(3-nitrophenyl)prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-20(2)28(26,27)17-7-8-18-15(13-17)10-11-21(18)19(23)9-6-14-4-3-5-16(12-14)22(24)25/h3-9,12-13H,10-11H2,1-2H3/b9-6+ |
| InChIKey | VGMLLHPNSOHOLT-RMKNXTFCSA-N |
| XLogP | 2.45 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|