C20H17N5O3 — CID 16962962
(E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 16962962) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 16962962 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (E)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)/C=C/c2cccc([N+](=O)[O-])c2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C20H17N5O3/c1-23-11-12-24(20-19(23)21-16-7-2-3-8-17(16)22-20)18(26)10-9-14-5-4-6-15(13-14)25(27)28/h2-10,13H,11-12H2,1H3/b10-9+ |
| InChIKey | FSAFKDHKGHZPSU-MDZDMXLPSA-N |
| XLogP | 3.03 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|