C26H26N2O3S — CID 41310347
(E)-1-(4-benzoylpiperidin-1-yl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one (PubChem CID 41310347) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is (E)-1-(4-benzoylpiperidin-1-yl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 41310347 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (E)-1-(4-benzoylpiperidin-1-yl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)N3CCC(C(=O)c4ccccc4)CC3)c2)cs1 |
| InChI | InChI=1S/C26H26N2O3S/c1-19-27-23(18-32-19)17-31-24-9-5-6-20(16-24)10-11-25(29)28-14-12-22(13-15-28)26(30)21-7-3-2-4-8-21/h2-11,16,18,22H,12-15,17H2,1H3/b11-10+ |
| InChIKey | BHJHSHAORMXRQH-ZHACJKMWSA-N |
| XLogP | 5.17 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|