C22H22N2O2S — CID 16590226
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide (PubChem CID 16590226) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 16590226 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NC(C)c3ccccc3)c2)cs1 |
| InChI | InChI=1S/C22H22N2O2S/c1-16(19-8-4-3-5-9-19)23-22(25)12-11-18-7-6-10-21(13-18)26-14-20-15-27-17(2)24-20/h3-13,15-16H,14H2,1-2H3,(H,23,25)/b12-11+ |
| InChIKey | ADPFESKLHWDVRF-VAWYXSNFSA-N |
| XLogP | 4.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|