C26H29N3O2S — CID 46493607
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)prop-2-enamide (PubChem CID 46493607) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 46493607 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NCC(c3ccccc3)N3CCCC3)c2)cs1 |
| InChI | InChI=1S/C26H29N3O2S/c1-20-28-23(19-32-20)18-31-24-11-7-8-21(16-24)12-13-26(30)27-17-25(29-14-5-6-15-29)22-9-3-2-4-10-22/h2-4,7-13,16,19,25H,5-6,14-15,17-18H2,1H3,(H,27,30)/b13-12+ |
| InChIKey | UBFFIRXRACDHBW-OUKQBFOZSA-N |
| XLogP | 5.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|