C21H20N2O2S2 — CID 24593016
(E)-N-(2-methylsulfanylphenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 24593016) has the molecular formula C21H20N2O2S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (E)-N-(2-methylsulfanylphenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-methylsulfanylphenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24593016 |
| Molecular Formula | C21H20N2O2S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (E)-N-(2-methylsulfanylphenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | CSc1ccccc1NC(=O)/C=C/c1cccc(OCc2csc(C)n2)c1 |
| InChI | InChI=1S/C21H20N2O2S2/c1-15-22-17(14-27-15)13-25-18-7-5-6-16(12-18)10-11-21(24)23-19-8-3-4-9-20(19)26-2/h3-12,14H,13H2,1-2H3,(H,23,24)/b11-10+ |
| InChIKey | SHRSRNWOOILISX-ZHACJKMWSA-N |
| XLogP | 5.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|