C22H22N2O2S2 — CID 26130380
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenylsulfanylethyl)prop-2-enamide (PubChem CID 26130380) has the molecular formula C22H22N2O2S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenylsulfanylethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenylsulfanylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26130380 |
| Molecular Formula | C22H22N2O2S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(2-phenylsulfanylethyl)prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NCCSc3ccccc3)c2)cs1 |
| InChI | InChI=1S/C22H22N2O2S2/c1-17-24-19(16-28-17)15-26-20-7-5-6-18(14-20)10-11-22(25)23-12-13-27-21-8-3-2-4-9-21/h2-11,14,16H,12-13,15H2,1H3,(H,23,25)/b11-10+ |
| InChIKey | NGOCMUAYSCWYTE-ZHACJKMWSA-N |
| XLogP | 4.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|