C21H21N3O2S — CID 46491012
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-pyridin-2-ylethyl)prop-2-enamide (PubChem CID 46491012) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-pyridin-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-pyridin-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 46491012 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-(1-pyridin-2-ylethyl)prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NC(C)c3ccccn3)c2)cs1 |
| InChI | InChI=1S/C21H21N3O2S/c1-15(20-8-3-4-11-22-20)23-21(25)10-9-17-6-5-7-19(12-17)26-13-18-14-27-16(2)24-18/h3-12,14-15H,13H2,1-2H3,(H,23,25)/b10-9+ |
| InChIKey | FIUPOVWFTXXFFQ-MDZDMXLPSA-N |
| XLogP | 4.32 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|