C22H19F3N2O3S — CID 75390651
(E)-N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 75390651) has the molecular formula C22H19F3N2O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is (E)-N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75390651 |
| Molecular Formula | C22H19F3N2O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (E)-N-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)NC(CO)c3cc(F)c(F)c(F)c3)c2)cs1 |
| InChI | InChI=1S/C22H19F3N2O3S/c1-13-26-16(12-31-13)11-30-17-4-2-3-14(7-17)5-6-21(29)27-20(10-28)15-8-18(23)22(25)19(24)9-15/h2-9,12,20,28H,10-11H2,1H3,(H,27,29)/b6-5+ |
| InChIKey | OUVCVQXFJAYBEX-AATRIKPKSA-N |
| XLogP | 4.31 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|