C20H16FN3O4S — CID 26017218
(E)-N-(4-fluoro-3-nitrophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 26017218) has the molecular formula C20H16FN3O4S and a molecular weight of 413.43 g/mol. Its IUPAC name is (E)-N-(4-fluoro-3-nitrophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-fluoro-3-nitrophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26017218 |
| Molecular Formula | C20H16FN3O4S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (E)-N-(4-fluoro-3-nitrophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)Nc3ccc(F)c([N+](=O)[O-])c3)c2)cs1 |
| InChI | InChI=1S/C20H16FN3O4S/c1-13-22-16(12-29-13)11-28-17-4-2-3-14(9-17)5-8-20(25)23-15-6-7-18(21)19(10-15)24(26)27/h2-10,12H,11H2,1H3,(H,23,25)/b8-5+ |
| InChIKey | QDUGYHRTISYTDE-VMPITWQZSA-N |
| XLogP | 4.73 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|