C24H22ClN3O3S — CID 55805405
2-chloro-N-cyclopropyl-4-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]benzamide (PubChem CID 55805405) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-4-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-4-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 55805405 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-chloro-N-cyclopropyl-4-[3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]benzamide |
| SMILES | Cc1nc(COc2cccc(C=CC(=O)Nc3ccc(C(=O)NC4CC4)c(Cl)c3)c2)cs1 |
| InChI | InChI=1S/C24H22ClN3O3S/c1-15-26-19(14-32-15)13-31-20-4-2-3-16(11-20)5-10-23(29)27-18-8-9-21(22(25)12-18)24(30)28-17-6-7-17/h2-5,8-12,14,17H,6-7,13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | HUKZFMOZKDICEX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|