C20H17IN2O2S — CID 16590459
(E)-N-(2-iodophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 16590459) has the molecular formula C20H17IN2O2S and a molecular weight of 476.34 g/mol. Its IUPAC name is (E)-N-(2-iodophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-iodophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16590459 |
| Molecular Formula | C20H17IN2O2S |
| Molecular Weight | 476.34 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | (E)-N-(2-iodophenyl)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2cccc(/C=C/C(=O)Nc3ccccc3I)c2)cs1 |
| InChI | InChI=1S/C20H17IN2O2S/c1-14-22-16(13-26-14)12-25-17-6-4-5-15(11-17)9-10-20(24)23-19-8-3-2-7-18(19)21/h2-11,13H,12H2,1H3,(H,23,24)/b10-9+ |
| InChIKey | SVXIHRPLIGUEJD-MDZDMXLPSA-N |
| XLogP | 5.29 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|