C24H22N2O6S — CID 24592836
dimethyl 5-[[(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 24592836) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is dimethyl 5-[[(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 24592836 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | dimethyl 5-[[(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/c2cccc(OCc3csc(C)n3)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H22N2O6S/c1-15-25-20(14-33-15)13-32-21-6-4-5-16(9-21)7-8-22(27)26-19-11-17(23(28)30-2)10-18(12-19)24(29)31-3/h4-12,14H,13H2,1-3H3,(H,26,27)/b8-7+ |
| InChIKey | NPEKLSWCZVAHHF-BQYQJAHWSA-N |
| XLogP | 4.26 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|