C22H19ClN2O4S — CID 38238010
methyl 2-chloro-5-[[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 38238010) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is methyl 2-chloro-5-[[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 38238010 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | methyl 2-chloro-5-[[(E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/c2ccc(OCc3csc(C)n3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O4S/c1-14-24-17(13-30-14)12-29-18-7-3-15(4-8-18)5-10-21(26)25-16-6-9-20(23)19(11-16)22(27)28-2/h3-11,13H,12H2,1-2H3,(H,25,26)/b10-5+ |
| InChIKey | UKVAFHWJRGVZST-BJMVGYQFSA-N |
| XLogP | 5.12 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|