C20H18N2O4S2 — CID 75866495
methyl 3-[3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]thiophene-2-carboxylate (PubChem CID 75866495) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is methyl 3-[3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 75866495 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | methyl 3-[3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)C=Cc1ccc(OCc2csc(C)n2)cc1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-13-21-15(12-28-13)11-26-16-6-3-14(4-7-16)5-8-18(23)22-17-9-10-27-19(17)20(24)25-2/h3-10,12H,11H2,1-2H3,(H,22,23) |
| InChIKey | GXFYCQWMTXDRTM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|